C28H40FN5O4S — CID 58737836
(2R,4S,5S)-4-amino-5-[[2-(1,1-dioxo-5-propan-2-yl-1,2,5-thiadiazolidin-2-yl)-2-methylpropanoyl]amino]-N-(4-fluorophenyl)-2-methyl-6-phenylhexanamide (PubChem CID 58737836) has the molecular formula C28H40FN5O4S and a molecular weight of 561.72 g/mol. Its IUPAC name is (2R,4S,5S)-4-amino-5-[[2-(1,1-dioxo-5-propan-2-yl-1,2,5-thiadiazolidin-2-yl)-2-methylpropanoyl]amino]-N-(4-fluorophenyl)-2-methyl-6-phenylhexanamide.
| Compound Name | (2R,4S,5S)-4-amino-5-[[2-(1,1-dioxo-5-propan-2-yl-1,2,5-thiadiazolidin-2-yl)-2-methylpropanoyl]amino]-N-(4-fluorophenyl)-2-methyl-6-phenylhexanamide |
|---|---|
| PubChem CID | 58737836 |
| Molecular Formula | C28H40FN5O4S |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | (2R,4S,5S)-4-amino-5-[[2-(1,1-dioxo-5-propan-2-yl-1,2,5-thiadiazolidin-2-yl)-2-methylpropanoyl]amino]-N-(4-fluorophenyl)-2-methyl-6-phenylhexanamide |
| SMILES | CC(C)N1CCN(C(C)(C)C(=O)N[C@@H](Cc2ccccc2)[C@@H](N)C[C@@H](C)C(=O)Nc2ccc(F)cc2)S1(=O)=O |
| InChI | InChI=1S/C28H40FN5O4S/c1-19(2)33-15-16-34(39(33,37)38)28(4,5)27(36)32-25(18-21-9-7-6-8-10-21)24(30)17-20(3)26(35)31-23-13-11-22(29)12-14-23/h6-14,19-20,24-25H,15-18,30H2,1-5H3,(H,31,35)(H,32,36)/t20-,24+,25+/m1/s1 |
| InChIKey | SAJKNVCEOZWWKQ-YNJKOYDBSA-N |
| XLogP | 2.89 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |