C32H40FN5O4S — CID 58737976
(2R,4S,5S)-4-amino-5-[[(2S)-2-(2-benzyl-1,1-dioxo-1,2,5-thiadiazinan-5-yl)propanoyl]amino]-N-(4-fluorophenyl)-2-methyl-6-phenylhexanamide (PubChem CID 58737976) has the molecular formula C32H40FN5O4S and a molecular weight of 609.77 g/mol. Its IUPAC name is (2R,4S,5S)-4-amino-5-[[(2S)-2-(2-benzyl-1,1-dioxo-1,2,5-thiadiazinan-5-yl)propanoyl]amino]-N-(4-fluorophenyl)-2-methyl-6-phenylhexanamide.
| Compound Name | (2R,4S,5S)-4-amino-5-[[(2S)-2-(2-benzyl-1,1-dioxo-1,2,5-thiadiazinan-5-yl)propanoyl]amino]-N-(4-fluorophenyl)-2-methyl-6-phenylhexanamide |
|---|---|
| PubChem CID | 58737976 |
| Molecular Formula | C32H40FN5O4S |
| Molecular Weight | 609.77 g/mol |
| Exact Mass | 609.28 |
| IUPAC Name | (2R,4S,5S)-4-amino-5-[[(2S)-2-(2-benzyl-1,1-dioxo-1,2,5-thiadiazinan-5-yl)propanoyl]amino]-N-(4-fluorophenyl)-2-methyl-6-phenylhexanamide |
| SMILES | C[C@H](C[C@H](N)[C@H](Cc1ccccc1)NC(=O)[C@H](C)N1CCN(Cc2ccccc2)S(=O)(=O)C1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C32H40FN5O4S/c1-23(31(39)35-28-15-13-27(33)14-16-28)19-29(34)30(20-25-9-5-3-6-10-25)36-32(40)24(2)37-17-18-38(43(41,42)22-37)21-26-11-7-4-8-12-26/h3-16,23-24,29-30H,17-22,34H2,1-2H3,(H,35,39)(H,36,40)/t23-,24+,29+,30+/m1/s1 |
| InChIKey | GIXXVKNEWFCKOO-GCDSYTDFSA-N |
| XLogP | 3.34 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.77 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |