C29H42FN5O4S — CID 58737896
(2R,4S,5S)-4-amino-N-(4-fluorophenyl)-2-methyl-5-[[(2S)-2-[2-(2-methylpropyl)-1,1-dioxo-1,2,5-thiadiazinan-5-yl]propanoyl]amino]-6-phenylhexanamide (PubChem CID 58737896) has the molecular formula C29H42FN5O4S and a molecular weight of 575.75 g/mol. Its IUPAC name is (2R,4S,5S)-4-amino-N-(4-fluorophenyl)-2-methyl-5-[[(2S)-2-[2-(2-methylpropyl)-1,1-dioxo-1,2,5-thiadiazinan-5-yl]propanoyl]amino]-6-phenylhexanamide.
| Compound Name | (2R,4S,5S)-4-amino-N-(4-fluorophenyl)-2-methyl-5-[[(2S)-2-[2-(2-methylpropyl)-1,1-dioxo-1,2,5-thiadiazinan-5-yl]propanoyl]amino]-6-phenylhexanamide |
|---|---|
| PubChem CID | 58737896 |
| Molecular Formula | C29H42FN5O4S |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 575.29 |
| IUPAC Name | (2R,4S,5S)-4-amino-N-(4-fluorophenyl)-2-methyl-5-[[(2S)-2-[2-(2-methylpropyl)-1,1-dioxo-1,2,5-thiadiazinan-5-yl]propanoyl]amino]-6-phenylhexanamide |
| SMILES | CC(C)CN1CCN([C@@H](C)C(=O)N[C@@H](Cc2ccccc2)[C@@H](N)C[C@@H](C)C(=O)Nc2ccc(F)cc2)CS1(=O)=O |
| InChI | InChI=1S/C29H42FN5O4S/c1-20(2)18-35-15-14-34(19-40(35,38)39)22(4)29(37)33-27(17-23-8-6-5-7-9-23)26(31)16-21(3)28(36)32-25-12-10-24(30)11-13-25/h5-13,20-22,26-27H,14-19,31H2,1-4H3,(H,32,36)(H,33,37)/t21-,22+,26+,27+/m1/s1 |
| InChIKey | CNSNPNRLTZRKHU-SEEQBUNISA-N |
| XLogP | 2.79 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |