C30H42FN5O4S — CID 58738186
(2R,4S,5S)-4-amino-5-[[2-[2-(cyclopropylmethyl)-1,1-dioxo-1,2,5-thiadiazinan-5-yl]-2-methylpropanoyl]amino]-N-(4-fluorophenyl)-2-methyl-6-phenylhexanamide (PubChem CID 58738186) has the molecular formula C30H42FN5O4S and a molecular weight of 587.76 g/mol. Its IUPAC name is (2R,4S,5S)-4-amino-5-[[2-[2-(cyclopropylmethyl)-1,1-dioxo-1,2,5-thiadiazinan-5-yl]-2-methylpropanoyl]amino]-N-(4-fluorophenyl)-2-methyl-6-phenylhexanamide.
| Compound Name | (2R,4S,5S)-4-amino-5-[[2-[2-(cyclopropylmethyl)-1,1-dioxo-1,2,5-thiadiazinan-5-yl]-2-methylpropanoyl]amino]-N-(4-fluorophenyl)-2-methyl-6-phenylhexanamide |
|---|---|
| PubChem CID | 58738186 |
| Molecular Formula | C30H42FN5O4S |
| Molecular Weight | 587.76 g/mol |
| Exact Mass | 587.29 |
| IUPAC Name | (2R,4S,5S)-4-amino-5-[[2-[2-(cyclopropylmethyl)-1,1-dioxo-1,2,5-thiadiazinan-5-yl]-2-methylpropanoyl]amino]-N-(4-fluorophenyl)-2-methyl-6-phenylhexanamide |
| SMILES | C[C@H](C[C@H](N)[C@H](Cc1ccccc1)NC(=O)C(C)(C)N1CCN(CC2CC2)S(=O)(=O)C1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C30H42FN5O4S/c1-21(28(37)33-25-13-11-24(31)12-14-25)17-26(32)27(18-22-7-5-4-6-8-22)34-29(38)30(2,3)35-15-16-36(19-23-9-10-23)41(39,40)20-35/h4-8,11-14,21,23,26-27H,9-10,15-20,32H2,1-3H3,(H,33,37)(H,34,38)/t21-,26+,27+/m1/s1 |
| InChIKey | BFDSQPWLLMDQRV-AIGMYPEUSA-N |
| XLogP | 2.94 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.76 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |