C36H55N7O3 — CID 58737863
1-N-[(4S,5S,7R)-5-azido-8-[[(2S)-1-(benzylamino)-3-methyl-1-oxobutan-2-yl]amino]-2,7-dimethyloctan-4-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 58737863) has the molecular formula C36H55N7O3 and a molecular weight of 633.88 g/mol. Its IUPAC name is 1-N-[(4S,5S,7R)-5-azido-8-[[(2S)-1-(benzylamino)-3-methyl-1-oxobutan-2-yl]amino]-2,7-dimethyloctan-4-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(4S,5S,7R)-5-azido-8-[[(2S)-1-(benzylamino)-3-methyl-1-oxobutan-2-yl]amino]-2,7-dimethyloctan-4-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 58737863 |
| Molecular Formula | C36H55N7O3 |
| Molecular Weight | 633.88 g/mol |
| Exact Mass | 633.44 |
| IUPAC Name | 1-N-[(4S,5S,7R)-5-azido-8-[[(2S)-1-(benzylamino)-3-methyl-1-oxobutan-2-yl]amino]-2,7-dimethyloctan-4-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)N[C@@H](CC(C)C)[C@H](C[C@@H](C)CN[C@H](C(=O)NCc2ccccc2)C(C)C)N=[N+]=[N-])c1 |
| InChI | InChI=1S/C36H55N7O3/c1-8-18-43(19-9-2)36(46)30-17-13-16-29(22-30)34(44)40-31(20-25(3)4)32(41-42-37)21-27(7)23-38-33(26(5)6)35(45)39-24-28-14-11-10-12-15-28/h10-17,22,25-27,31-33,38H,8-9,18-21,23-24H2,1-7H3,(H,39,45)(H,40,44)/t27-,31+,32+,33+/m1/s1 |
| InChIKey | ZIAYNRLEGUYISA-XQSZSLLBSA-N |
| XLogP | 6.73 |
| TPSA | 139.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.88 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|