C52H42N2 — CID 58738519
4-[9,18-bis(4-tert-butylphenyl)-22-pyridin-4-yl-12-hexacyclo[11.7.1.14,20.02,11.03,8.017,21]docosa-1,3(8),4,6,9,11,13,15,17(21),18,20(22)-undecaenyl]pyridine (PubChem CID 58738519) has the molecular formula C52H42N2 and a molecular weight of 694.92 g/mol. Its IUPAC name is 4-[9,18-bis(4-tert-butylphenyl)-22-pyridin-4-yl-12-hexacyclo[11.7.1.14,20.02,11.03,8.017,21]docosa-1,3(8),4,6,9,11,13,15,17(21),18,20(22)-undecaenyl]pyridine.
| Compound Name | 4-[9,18-bis(4-tert-butylphenyl)-22-pyridin-4-yl-12-hexacyclo[11.7.1.14,20.02,11.03,8.017,21]docosa-1,3(8),4,6,9,11,13,15,17(21),18,20(22)-undecaenyl]pyridine |
|---|---|
| PubChem CID | 58738519 |
| Molecular Formula | C52H42N2 |
| Molecular Weight | 694.92 g/mol |
| Exact Mass | 694.33 |
| IUPAC Name | 4-[9,18-bis(4-tert-butylphenyl)-22-pyridin-4-yl-12-hexacyclo[11.7.1.14,20.02,11.03,8.017,21]docosa-1,3(8),4,6,9,11,13,15,17(21),18,20(22)-undecaenyl]pyridine |
| SMILES | CC(C)(C)c1ccc(-c2cc3c(-c4ccncc4)c4cccc5c(-c6ccc(C(C)(C)C)cc6)cc6c(-c7ccncc7)c7cccc2c7c3c6c54)cc1 |
| InChI | InChI=1S/C52H42N2/c1-51(2,3)35-17-13-31(14-18-35)41-29-43-45(33-21-25-53-26-22-33)40-12-8-10-38-42(32-15-19-36(20-16-32)52(4,5)6)30-44-46(34-23-27-54-28-24-34)39-11-7-9-37(41)47(39)49(43)50(44)48(38)40/h7-30H,1-6H3 |
| InChIKey | AQYFLYJXONRCTD-UHFFFAOYSA-N |
| XLogP | 14.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.92 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|