C23H25N3O4 — CID 58740530
(E)-3-[4-[(6-methoxy-1H-benzimidazol-2-yl)methyl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 58740530) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is (E)-3-[4-[(6-methoxy-1H-benzimidazol-2-yl)methyl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | (E)-3-[4-[(6-methoxy-1H-benzimidazol-2-yl)methyl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 58740530 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | (E)-3-[4-[(6-methoxy-1H-benzimidazol-2-yl)methyl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | COc1ccc2nc(Cc3ccc(/C=C/C(=O)NOC4CCCCO4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C23H25N3O4/c1-28-18-10-11-19-20(15-18)25-21(24-19)14-17-7-5-16(6-8-17)9-12-22(27)26-30-23-4-2-3-13-29-23/h5-12,15,23H,2-4,13-14H2,1H3,(H,24,25)(H,26,27)/b12-9+ |
| InChIKey | LQWBCZIVOUJVQH-FMIVXFBMSA-N |
| XLogP | 3.75 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|