C27H30N4O5 — CID 58740809
N-methoxy-N-methyl-2-[[4-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]phenyl]methyl]-4-phenyl-1H-imidazole-5-carboxamide (PubChem CID 58740809) has the molecular formula C27H30N4O5 and a molecular weight of 490.56 g/mol. Its IUPAC name is N-methoxy-N-methyl-2-[[4-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]phenyl]methyl]-4-phenyl-1H-imidazole-5-carboxamide.
| Compound Name | N-methoxy-N-methyl-2-[[4-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]phenyl]methyl]-4-phenyl-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 58740809 |
| Molecular Formula | C27H30N4O5 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | N-methoxy-N-methyl-2-[[4-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]phenyl]methyl]-4-phenyl-1H-imidazole-5-carboxamide |
| SMILES | CON(C)C(=O)c1[nH]c(Cc2ccc(/C=C/C(=O)NOC3CCCCO3)cc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C27H30N4O5/c1-31(34-2)27(33)26-25(21-8-4-3-5-9-21)28-22(29-26)18-20-13-11-19(12-14-20)15-16-23(32)30-36-24-10-6-7-17-35-24/h3-5,8-9,11-16,24H,6-7,10,17-18H2,1-2H3,(H,28,29)(H,30,32)/b16-15+ |
| InChIKey | NLFXZJNLTYFBPG-FOCLMDBBSA-N |
| XLogP | 3.89 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|