C14H14BrClN5O+ — CID 58742196
4-bromo-7-[(4-chloro-1-hydroxy-3,5-dimethylpyridin-1-ium-2-yl)methyl]pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 58742196) has the molecular formula C14H14BrClN5O+ and a molecular weight of 383.66 g/mol. Its IUPAC name is 4-bromo-7-[(4-chloro-1-hydroxy-3,5-dimethylpyridin-1-ium-2-yl)methyl]pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-bromo-7-[(4-chloro-1-hydroxy-3,5-dimethylpyridin-1-ium-2-yl)methyl]pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 58742196 |
| Molecular Formula | C14H14BrClN5O+ |
| Molecular Weight | 383.66 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | 4-bromo-7-[(4-chloro-1-hydroxy-3,5-dimethylpyridin-1-ium-2-yl)methyl]pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | Cc1c[n+](O)c(Cn2ccc3c(Br)nc(N)nc32)c(C)c1Cl |
| InChI | InChI=1S/C14H14BrClN5O/c1-7-5-21(22)10(8(2)11(7)16)6-20-4-3-9-12(15)18-14(17)19-13(9)20/h3-5,22H,6H2,1-2H3,(H2,17,18,19)/q+1 |
| InChIKey | YPLDMJTXPBIGJI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 80.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.66 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|