C22H29NO3S — CID 58742370
(2S,3R,4aR,10aR)-2-(4,5-dimethyl-1,3-thiazol-2-yl)-4a-ethyl-3-methyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol (PubChem CID 58742370) has the molecular formula C22H29NO3S and a molecular weight of 387.55 g/mol. Its IUPAC name is (2S,3R,4aR,10aR)-2-(4,5-dimethyl-1,3-thiazol-2-yl)-4a-ethyl-3-methyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol.
| Compound Name | (2S,3R,4aR,10aR)-2-(4,5-dimethyl-1,3-thiazol-2-yl)-4a-ethyl-3-methyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol |
|---|---|
| PubChem CID | 58742370 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | (2S,3R,4aR,10aR)-2-(4,5-dimethyl-1,3-thiazol-2-yl)-4a-ethyl-3-methyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol |
| SMILES | CC[C@@]12C[C@@](C)(O)[C@](O)(c3nc(C)c(C)s3)C[C@H]1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C22H29NO3S/c1-5-21-12-20(4,25)22(26,19-23-13(2)14(3)27-19)11-16(21)7-6-15-10-17(24)8-9-18(15)21/h8-10,16,24-26H,5-7,11-12H2,1-4H3/t16-,20-,21-,22-/m1/s1 |
| InChIKey | ZVJKWLWSKVHZMH-XUFNMVPLSA-N |
| XLogP | 4.11 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |