C14H18N5O4+ — CID 58754402
7,8-dihydroxy-7,9-dimethyl-3-prop-2-enyl-8,10-dihydropyrimido[2,1-f]purin-6-ium-9-carboxylic acid (PubChem CID 58754402) has the molecular formula C14H18N5O4+ and a molecular weight of 320.33 g/mol. Its IUPAC name is 7,8-dihydroxy-7,9-dimethyl-3-prop-2-enyl-8,10-dihydropyrimido[2,1-f]purin-6-ium-9-carboxylic acid.
| Compound Name | 7,8-dihydroxy-7,9-dimethyl-3-prop-2-enyl-8,10-dihydropyrimido[2,1-f]purin-6-ium-9-carboxylic acid |
|---|---|
| PubChem CID | 58754402 |
| Molecular Formula | C14H18N5O4+ |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 7,8-dihydroxy-7,9-dimethyl-3-prop-2-enyl-8,10-dihydropyrimido[2,1-f]purin-6-ium-9-carboxylic acid |
| SMILES | C=CCn1cnc2c3[n+](cnc21)C(C)(O)C(O)C(C)(C(=O)O)N3 |
| InChI | InChI=1S/C14H17N5O4/c1-4-5-18-6-15-8-9(18)16-7-19-10(8)17-13(2,12(21)22)11(20)14(19,3)23/h4,6-7,11,20,23H,1,5H2,2-3H3,(H,21,22)/p+1 |
| InChIKey | JPGIAOBCYZRGFF-UHFFFAOYSA-O |
| XLogP | -0.80 |
| TPSA | 124.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|