C11H13N5O4 — CID 11323431
(7R,8S,9S)-7,8-dihydroxy-7,9-dimethyl-8,10-dihydro-1H-pyrimido[2,1-f]purin-6-ium-9-carboxylate (PubChem CID 11323431) has the molecular formula C11H13N5O4 and a molecular weight of 279.26 g/mol. Its IUPAC name is (7R,8S,9S)-7,8-dihydroxy-7,9-dimethyl-8,10-dihydro-1H-pyrimido[2,1-f]purin-6-ium-9-carboxylate.
| Compound Name | (7R,8S,9S)-7,8-dihydroxy-7,9-dimethyl-8,10-dihydro-1H-pyrimido[2,1-f]purin-6-ium-9-carboxylate |
|---|---|
| PubChem CID | 11323431 |
| Molecular Formula | C11H13N5O4 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (7R,8S,9S)-7,8-dihydroxy-7,9-dimethyl-8,10-dihydro-1H-pyrimido[2,1-f]purin-6-ium-9-carboxylate |
| SMILES | C[C@]1(C(=O)[O-])Nc2c3[nH]cnc3nc[n+]2[C@](C)(O)[C@H]1O |
| InChI | InChI=1S/C11H13N5O4/c1-10(9(18)19)8(17)11(2,20)16-4-14-6-5(7(16)15-10)12-3-13-6/h3-4,8,17,20H,1-2H3,(H2,12,13,15,18,19)/t8-,10-,11+/m0/s1 |
| InChIKey | OQPJWDNHTPAGBZ-INTQDDNPSA-N |
| XLogP | -2.79 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|