C14H15N5O4 — CID 90683313
(7R,8R,9S)-7,8-dihydroxy-7,9-dimethyl-3-prop-2-ynyl-8,10-dihydropyrimido[2,1-f]purin-6-ium-9-carboxylate (PubChem CID 90683313) has the molecular formula C14H15N5O4 and a molecular weight of 317.31 g/mol. Its IUPAC name is (7R,8R,9S)-7,8-dihydroxy-7,9-dimethyl-3-prop-2-ynyl-8,10-dihydropyrimido[2,1-f]purin-6-ium-9-carboxylate.
| Compound Name | (7R,8R,9S)-7,8-dihydroxy-7,9-dimethyl-3-prop-2-ynyl-8,10-dihydropyrimido[2,1-f]purin-6-ium-9-carboxylate |
|---|---|
| PubChem CID | 90683313 |
| Molecular Formula | C14H15N5O4 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | (7R,8R,9S)-7,8-dihydroxy-7,9-dimethyl-3-prop-2-ynyl-8,10-dihydropyrimido[2,1-f]purin-6-ium-9-carboxylate |
| SMILES | C#CCn1cnc2c3[n+](cnc21)[C@](C)(O)[C@H](O)[C@@](C)(C(=O)[O-])N3 |
| InChI | InChI=1S/C14H15N5O4/c1-4-5-18-6-15-8-9(18)16-7-19-10(8)17-13(2,12(21)22)11(20)14(19,3)23/h1,6-7,11,20,23H,5H2,2-3H3,(H,21,22)/t11-,13+,14-/m1/s1 |
| InChIKey | YVFVDFCROVYESJ-KWCYVHTRSA-N |
| XLogP | -2.69 |
| TPSA | 127.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|