C29H22F6O2 — CID 58756004
[4-[6-methyl-5,7-bis(trifluoromethyl)naphthalen-2-yl]phenyl] 2,4,6-trimethylbenzoate (PubChem CID 58756004) has the molecular formula C29H22F6O2 and a molecular weight of 516.48 g/mol. Its IUPAC name is [4-[6-methyl-5,7-bis(trifluoromethyl)naphthalen-2-yl]phenyl] 2,4,6-trimethylbenzoate.
| Compound Name | [4-[6-methyl-5,7-bis(trifluoromethyl)naphthalen-2-yl]phenyl] 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 58756004 |
| Molecular Formula | C29H22F6O2 |
| Molecular Weight | 516.48 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | [4-[6-methyl-5,7-bis(trifluoromethyl)naphthalen-2-yl]phenyl] 2,4,6-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)Oc2ccc(-c3ccc4c(C(F)(F)F)c(C)c(C(F)(F)F)cc4c3)cc2)c(C)c1 |
| InChI | InChI=1S/C29H22F6O2/c1-15-11-16(2)25(17(3)12-15)27(36)37-22-8-5-19(6-9-22)20-7-10-23-21(13-20)14-24(28(30,31)32)18(4)26(23)29(33,34)35/h5-14H,1-4H3 |
| InChIKey | AVOWTDCDFPZOQQ-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.48 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|