C21H32O — CID 58756548
(1R,3S,13S)-1,3,13,16-tetramethyl-2,3,4,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 58756548) has the molecular formula C21H32O and a molecular weight of 300.49 g/mol. Its IUPAC name is (1R,3S,13S)-1,3,13,16-tetramethyl-2,3,4,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (1R,3S,13S)-1,3,13,16-tetramethyl-2,3,4,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 58756548 |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | (1R,3S,13S)-1,3,13,16-tetramethyl-2,3,4,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC1CC2C3CC=C4C[C@@H](C)C[C@@H](C)C4C3CC[C@]2(C)C1=O |
| InChI | InChI=1S/C21H32O/c1-12-9-13(2)19-15(10-12)5-6-16-17(19)7-8-21(4)18(16)11-14(3)20(21)22/h5,12-14,16-19H,6-11H2,1-4H3/t12-,13+,14?,16?,17?,18?,19?,21-/m0/s1 |
| InChIKey | MCJDXWYZYHRVQQ-NTHFJVAISA-N |
| XLogP | 5.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|