C22H34O — CID 54385750
(2S,8R,9S,10R,13S,14S,16R)-2,6,10,13,16-pentamethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 54385750) has the molecular formula C22H34O and a molecular weight of 314.51 g/mol. Its IUPAC name is (2S,8R,9S,10R,13S,14S,16R)-2,6,10,13,16-pentamethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (2S,8R,9S,10R,13S,14S,16R)-2,6,10,13,16-pentamethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 54385750 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | (2S,8R,9S,10R,13S,14S,16R)-2,6,10,13,16-pentamethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CC1=C2CC[C@H](C)C[C@]2(C)[C@H]2CC[C@]3(C)C(=O)[C@H](C)C[C@H]3[C@@H]2C1 |
| InChI | InChI=1S/C22H34O/c1-13-6-7-17-14(2)10-16-18(22(17,5)12-13)8-9-21(4)19(16)11-15(3)20(21)23/h13,15-16,18-19H,6-12H2,1-5H3/t13-,15+,16+,18-,19-,21-,22-/m0/s1 |
| InChIKey | VDCTZTCOCZKHKP-PJCZOTEMSA-N |
| XLogP | 5.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|