C32H40O5SSi — CID 58758286
[(6S,8S,8aS)-2-phenyl-8-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 58758286) has the molecular formula C32H40O5SSi and a molecular weight of 564.82 g/mol. Its IUPAC name is [(6S,8S,8aS)-2-phenyl-8-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(6S,8S,8aS)-2-phenyl-8-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 58758286 |
| Molecular Formula | C32H40O5SSi |
| Molecular Weight | 564.82 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | [(6S,8S,8aS)-2-phenyl-8-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1[C@@H](OCc2ccccc2)[C@H]2OC(c3ccccc3)OCC2O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C32H40O5SSi/c1-32(2,3)39(4,5)37-29-28(33-21-23-15-9-6-10-16-23)27-26(35-31(29)38-25-19-13-8-14-20-25)22-34-30(36-27)24-17-11-7-12-18-24/h6-20,26-31H,21-22H2,1-5H3/t26?,27-,28-,29?,30?,31-/m0/s1 |
| InChIKey | LOWDZFWOQUTKFH-JKECEAMBSA-N |
| XLogP | 7.59 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.82 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|