C12H22O6Si — CID 58761097
(2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2H-furan-5-one (PubChem CID 58761097) has the molecular formula C12H22O6Si and a molecular weight of 290.39 g/mol. Its IUPAC name is (2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2H-furan-5-one.
| Compound Name | (2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 58761097 |
| Molecular Formula | C12H22O6Si |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2H-furan-5-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C(O)[C@@H]([C@@H](O)CO)OC1=O |
| InChI | InChI=1S/C12H22O6Si/c1-12(2,3)19(4,5)18-10-8(15)9(7(14)6-13)17-11(10)16/h7,9,13-15H,6H2,1-5H3/t7-,9+/m0/s1 |
| InChIKey | RABPFXILDFPNCO-IONNQARKSA-N |
| XLogP | 1.06 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|