C28H27ClFN5O3 — CID 58762230
3-[(6-chloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-cyclopentyl-6-[2-[3-fluoro-4-(1-isocyanocyclopropyl)phenyl]ethyl]oxane-2,4-dione (PubChem CID 58762230) has the molecular formula C28H27ClFN5O3 and a molecular weight of 536.01 g/mol. Its IUPAC name is 3-[(6-chloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-cyclopentyl-6-[2-[3-fluoro-4-(1-isocyanocyclopropyl)phenyl]ethyl]oxane-2,4-dione.
| Compound Name | 3-[(6-chloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-cyclopentyl-6-[2-[3-fluoro-4-(1-isocyanocyclopropyl)phenyl]ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 58762230 |
| Molecular Formula | C28H27ClFN5O3 |
| Molecular Weight | 536.01 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 3-[(6-chloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-cyclopentyl-6-[2-[3-fluoro-4-(1-isocyanocyclopropyl)phenyl]ethyl]oxane-2,4-dione |
| SMILES | [C-]#[N+]C1(c2ccc(CCC3(C4CCCC4)CC(=O)C(Cc4nc5ncc(Cl)cn5n4)C(=O)O3)cc2F)CC1 |
| InChI | InChI=1S/C28H27ClFN5O3/c1-31-27(10-11-27)21-7-6-17(12-22(21)30)8-9-28(18-4-2-3-5-18)14-23(36)20(25(37)38-28)13-24-33-26-32-15-19(29)16-35(26)34-24/h6-7,12,15-16,18,20H,2-5,8-11,13-14H2 |
| InChIKey | HSUDWRUZNAYZGI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 90.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.01 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|