C30H34FN5O3 — CID 58762368
6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[3-fluoro-4-(2-isocyanopropan-2-yl)phenyl]ethyl]oxane-2,4-dione (PubChem CID 58762368) has the molecular formula C30H34FN5O3 and a molecular weight of 531.63 g/mol. Its IUPAC name is 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[3-fluoro-4-(2-isocyanopropan-2-yl)phenyl]ethyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[3-fluoro-4-(2-isocyanopropan-2-yl)phenyl]ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 58762368 |
| Molecular Formula | C30H34FN5O3 |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[3-fluoro-4-(2-isocyanopropan-2-yl)phenyl]ethyl]oxane-2,4-dione |
| SMILES | [C-]#[N+]C(C)(C)c1ccc(CCC2(C3CCCC3)CC(=O)C(Cc3nc4nc(C)cc(C)n4n3)C(=O)O2)cc1F |
| InChI | InChI=1S/C30H34FN5O3/c1-18-14-19(2)36-28(33-18)34-26(35-36)16-22-25(37)17-30(39-27(22)38,21-8-6-7-9-21)13-12-20-10-11-23(24(31)15-20)29(3,4)32-5/h10-11,14-15,21-22H,6-9,12-13,16-17H2,1-4H3 |
| InChIKey | NTLURPFLNNEUKI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 90.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|