C32H38FN5O3 — CID 58762514
6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[3-fluoro-4-(3-isocyanopentan-3-yl)phenyl]ethyl]oxane-2,4-dione (PubChem CID 58762514) has the molecular formula C32H38FN5O3 and a molecular weight of 559.69 g/mol. Its IUPAC name is 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[3-fluoro-4-(3-isocyanopentan-3-yl)phenyl]ethyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[3-fluoro-4-(3-isocyanopentan-3-yl)phenyl]ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 58762514 |
| Molecular Formula | C32H38FN5O3 |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[3-fluoro-4-(3-isocyanopentan-3-yl)phenyl]ethyl]oxane-2,4-dione |
| SMILES | [C-]#[N+]C(CC)(CC)c1ccc(CCC2(C3CCCC3)CC(=O)C(Cc3nc4nc(C)cc(C)n4n3)C(=O)O2)cc1F |
| InChI | InChI=1S/C32H38FN5O3/c1-6-31(7-2,34-5)25-13-12-22(17-26(25)33)14-15-32(23-10-8-9-11-23)19-27(39)24(29(40)41-32)18-28-36-30-35-20(3)16-21(4)38(30)37-28/h12-13,16-17,23-24H,6-11,14-15,18-19H2,1-4H3 |
| InChIKey | CLNKXICCUJJDJC-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 90.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|