C28H28FN5O3 — CID 58762370
6-cyclopentyl-6-[2-[3-fluoro-4-(1-isocyanocyclopropyl)phenyl]ethyl]-3-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylmethyl)oxane-2,4-dione (PubChem CID 58762370) has the molecular formula C28H28FN5O3 and a molecular weight of 501.56 g/mol. Its IUPAC name is 6-cyclopentyl-6-[2-[3-fluoro-4-(1-isocyanocyclopropyl)phenyl]ethyl]-3-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylmethyl)oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-6-[2-[3-fluoro-4-(1-isocyanocyclopropyl)phenyl]ethyl]-3-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylmethyl)oxane-2,4-dione |
|---|---|
| PubChem CID | 58762370 |
| Molecular Formula | C28H28FN5O3 |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 6-cyclopentyl-6-[2-[3-fluoro-4-(1-isocyanocyclopropyl)phenyl]ethyl]-3-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylmethyl)oxane-2,4-dione |
| SMILES | [C-]#[N+]C1(c2ccc(CCC3(C4CCCC4)CC(=O)C(Cc4nc5ncccn5n4)C(=O)O3)cc2F)CC1 |
| InChI | InChI=1S/C28H28FN5O3/c1-30-27(11-12-27)21-8-7-18(15-22(21)29)9-10-28(19-5-2-3-6-19)17-23(35)20(25(36)37-28)16-24-32-26-31-13-4-14-34(26)33-24/h4,7-8,13-15,19-20H,2-3,5-6,9-12,16-17H2 |
| InChIKey | BLXGBJFTHLZNEO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 90.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|