C21H27NO2 — CID 58763373
5-methyl-2-(3-methylphenyl)-4-[(3-prop-2-enylcyclohexyl)oxymethyl]-1,3-oxazole (PubChem CID 58763373) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 5-methyl-2-(3-methylphenyl)-4-[(3-prop-2-enylcyclohexyl)oxymethyl]-1,3-oxazole.
| Compound Name | 5-methyl-2-(3-methylphenyl)-4-[(3-prop-2-enylcyclohexyl)oxymethyl]-1,3-oxazole |
|---|---|
| PubChem CID | 58763373 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 5-methyl-2-(3-methylphenyl)-4-[(3-prop-2-enylcyclohexyl)oxymethyl]-1,3-oxazole |
| SMILES | C=CCC1CCCC(OCc2nc(-c3cccc(C)c3)oc2C)C1 |
| InChI | InChI=1S/C21H27NO2/c1-4-7-17-9-6-11-19(13-17)23-14-20-16(3)24-21(22-20)18-10-5-8-15(2)12-18/h4-5,8,10,12,17,19H,1,6-7,9,11,13-14H2,2-3H3 |
| InChIKey | MXSGSUKEKIPPTL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|