C30H37NO6 — CID 59820046
ethyl 2-methyl-6-[2-[(1R,3S)-3-[[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methoxy]cyclohexyl]oxyethoxy]benzoate (PubChem CID 59820046) has the molecular formula C30H37NO6 and a molecular weight of 507.63 g/mol. Its IUPAC name is ethyl 2-methyl-6-[2-[(1R,3S)-3-[[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methoxy]cyclohexyl]oxyethoxy]benzoate.
| Compound Name | ethyl 2-methyl-6-[2-[(1R,3S)-3-[[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methoxy]cyclohexyl]oxyethoxy]benzoate |
|---|---|
| PubChem CID | 59820046 |
| Molecular Formula | C30H37NO6 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | ethyl 2-methyl-6-[2-[(1R,3S)-3-[[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methoxy]cyclohexyl]oxyethoxy]benzoate |
| SMILES | CCOC(=O)c1c(C)cccc1OCCO[C@@H]1CCC[C@H](OCc2nc(-c3cccc(C)c3)oc2C)C1 |
| InChI | InChI=1S/C30H37NO6/c1-5-33-30(32)28-21(3)10-7-14-27(28)35-16-15-34-24-12-8-13-25(18-24)36-19-26-22(4)37-29(31-26)23-11-6-9-20(2)17-23/h6-7,9-11,14,17,24-25H,5,8,12-13,15-16,18-19H2,1-4H3/t24-,25+/m1/s1 |
| InChIKey | OJZRCHWQEYBDHI-RPBOFIJWSA-N |
| XLogP | 6.37 |
| TPSA | 80.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|