C21H27NO3 — CID 66888542
5-methyl-2-(3-methylphenyl)-4-[[(1R,3S)-3-prop-2-enoxycyclohexyl]oxymethyl]-1,3-oxazole (PubChem CID 66888542) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 5-methyl-2-(3-methylphenyl)-4-[[(1R,3S)-3-prop-2-enoxycyclohexyl]oxymethyl]-1,3-oxazole.
| Compound Name | 5-methyl-2-(3-methylphenyl)-4-[[(1R,3S)-3-prop-2-enoxycyclohexyl]oxymethyl]-1,3-oxazole |
|---|---|
| PubChem CID | 66888542 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 5-methyl-2-(3-methylphenyl)-4-[[(1R,3S)-3-prop-2-enoxycyclohexyl]oxymethyl]-1,3-oxazole |
| SMILES | C=CCO[C@H]1CCC[C@@H](OCc2nc(-c3cccc(C)c3)oc2C)C1 |
| InChI | InChI=1S/C21H27NO3/c1-4-11-23-18-9-6-10-19(13-18)24-14-20-16(3)25-21(22-20)17-8-5-7-15(2)12-17/h4-5,7-8,12,18-19H,1,6,9-11,13-14H2,2-3H3/t18-,19+/m0/s1 |
| InChIKey | KVNHEYRCTGTZOI-RBUKOAKNSA-N |
| XLogP | 4.99 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|