C30H45NO5Si — CID 87969767
tert-butyl-dimethyl-[3-[(1R,3S)-3-[[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methoxy]cyclohexyl]oxy-2-prop-2-ynoxypropoxy]silane (PubChem CID 87969767) has the molecular formula C30H45NO5Si and a molecular weight of 527.78 g/mol. Its IUPAC name is tert-butyl-dimethyl-[3-[(1R,3S)-3-[[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methoxy]cyclohexyl]oxy-2-prop-2-ynoxypropoxy]silane.
| Compound Name | tert-butyl-dimethyl-[3-[(1R,3S)-3-[[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methoxy]cyclohexyl]oxy-2-prop-2-ynoxypropoxy]silane |
|---|---|
| PubChem CID | 87969767 |
| Molecular Formula | C30H45NO5Si |
| Molecular Weight | 527.78 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | tert-butyl-dimethyl-[3-[(1R,3S)-3-[[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methoxy]cyclohexyl]oxy-2-prop-2-ynoxypropoxy]silane |
| SMILES | C#CCOC(CO[C@@H]1CCC[C@H](OCc2nc(-c3cccc(C)c3)oc2C)C1)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H45NO5Si/c1-9-16-32-27(20-35-37(7,8)30(4,5)6)19-33-25-14-11-15-26(18-25)34-21-28-23(3)36-29(31-28)24-13-10-12-22(2)17-24/h1,10,12-13,17,25-27H,11,14-16,18-21H2,2-8H3/t25-,26+,27?/m1/s1 |
| InChIKey | LENLQMWOQNESCO-JZGSEIKYSA-N |
| XLogP | 6.84 |
| TPSA | 62.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.78 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|