C21H28N4O3 — CID 59820042
4-[[(1S,3R)-3-(3-azidopropoxy)cyclohexyl]oxymethyl]-5-methyl-2-(3-methylphenyl)-1,3-oxazole (PubChem CID 59820042) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-[[(1S,3R)-3-(3-azidopropoxy)cyclohexyl]oxymethyl]-5-methyl-2-(3-methylphenyl)-1,3-oxazole.
| Compound Name | 4-[[(1S,3R)-3-(3-azidopropoxy)cyclohexyl]oxymethyl]-5-methyl-2-(3-methylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 59820042 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 4-[[(1S,3R)-3-(3-azidopropoxy)cyclohexyl]oxymethyl]-5-methyl-2-(3-methylphenyl)-1,3-oxazole |
| SMILES | Cc1cccc(-c2nc(CO[C@H]3CCC[C@@H](OCCCN=[N+]=[N-])C3)c(C)o2)c1 |
| InChI | InChI=1S/C21H28N4O3/c1-15-6-3-7-17(12-15)21-24-20(16(2)28-21)14-27-19-9-4-8-18(13-19)26-11-5-10-23-25-22/h3,6-7,12,18-19H,4-5,8-11,13-14H2,1-2H3/t18-,19+/m1/s1 |
| InChIKey | LPRXZEDLKCFWSS-MOPGFXCFSA-N |
| XLogP | 5.50 |
| TPSA | 93.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|