C28H46N2O4 — CID 58767857
tert-butyl 4-[4-(2-methoxyethoxy)-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]piperazine-1-carboxylate (PubChem CID 58767857) has the molecular formula C28H46N2O4 and a molecular weight of 474.69 g/mol. Its IUPAC name is tert-butyl 4-[4-(2-methoxyethoxy)-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(2-methoxyethoxy)-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58767857 |
| Molecular Formula | C28H46N2O4 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.35 |
| IUPAC Name | tert-butyl 4-[4-(2-methoxyethoxy)-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]piperazine-1-carboxylate |
| SMILES | COCCOc1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)c(C2CC(C)(C)CC(C)(C)C2)c1 |
| InChI | InChI=1S/C28H46N2O4/c1-26(2,3)34-25(31)30-13-11-29(12-14-30)24-10-9-22(33-16-15-32-8)17-23(24)21-18-27(4,5)20-28(6,7)19-21/h9-10,17,21H,11-16,18-20H2,1-8H3 |
| InChIKey | XIAXWSWHJCULLE-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|