C18H20N3NaO5 — CID 58769336
sodium 2-[5-(4-carbamimidoylphenoxy)pentoxy]-5-nitrophenolate (PubChem CID 58769336) has the molecular formula C18H20N3NaO5 and a molecular weight of 381.36 g/mol. Its IUPAC name is sodium 2-[5-(4-carbamimidoylphenoxy)pentoxy]-5-nitrophenolate.
| Compound Name | sodium 2-[5-(4-carbamimidoylphenoxy)pentoxy]-5-nitrophenolate |
|---|---|
| PubChem CID | 58769336 |
| Molecular Formula | C18H20N3NaO5 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | sodium 2-[5-(4-carbamimidoylphenoxy)pentoxy]-5-nitrophenolate |
| SMILES | [H]/N=C(\N)c1ccc(OCCCCCOc2ccc([N+](=O)[O-])cc2[O-])cc1.[Na+] |
| InChI | InChI=1S/C18H21N3O5.Na/c19-18(20)13-4-7-15(8-5-13)25-10-2-1-3-11-26-17-9-6-14(21(23)24)12-16(17)22;/h4-9,12,22H,1-3,10-11H2,(H3,19,20);/q;+1/p-1 |
| InChIKey | XKKSVNNXBAUUID-UHFFFAOYSA-M |
| XLogP | -0.42 |
| TPSA | 134.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|