C21H30FNO4S — CID 58770099
4-[2-[(2R)-2-[4-(3-fluorophenyl)-3-hydroxybutyl]-6-oxopiperidin-1-yl]ethylsulfanyl]butanoic acid (PubChem CID 58770099) has the molecular formula C21H30FNO4S and a molecular weight of 411.54 g/mol. Its IUPAC name is 4-[2-[(2R)-2-[4-(3-fluorophenyl)-3-hydroxybutyl]-6-oxopiperidin-1-yl]ethylsulfanyl]butanoic acid.
| Compound Name | 4-[2-[(2R)-2-[4-(3-fluorophenyl)-3-hydroxybutyl]-6-oxopiperidin-1-yl]ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 58770099 |
| Molecular Formula | C21H30FNO4S |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 4-[2-[(2R)-2-[4-(3-fluorophenyl)-3-hydroxybutyl]-6-oxopiperidin-1-yl]ethylsulfanyl]butanoic acid |
| SMILES | O=C(O)CCCSCCN1C(=O)CCC[C@@H]1CCC(O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C21H30FNO4S/c22-17-5-1-4-16(14-17)15-19(24)10-9-18-6-2-7-20(25)23(18)11-13-28-12-3-8-21(26)27/h1,4-5,14,18-19,24H,2-3,6-13,15H2,(H,26,27)/t18-,19?/m1/s1 |
| InChIKey | UVHBDWNHOCRXRO-MRTLOADZSA-N |
| XLogP | 3.49 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|