C10H18NOP — CID 58773526
(3R)-5,5-dimethyl-4-methylidene-1-phosphanyl-3-propylpyrrolidin-2-one (PubChem CID 58773526) has the molecular formula C10H18NOP and a molecular weight of 199.23 g/mol. Its IUPAC name is (3R)-5,5-dimethyl-4-methylidene-1-phosphanyl-3-propylpyrrolidin-2-one.
| Compound Name | (3R)-5,5-dimethyl-4-methylidene-1-phosphanyl-3-propylpyrrolidin-2-one |
|---|---|
| PubChem CID | 58773526 |
| Molecular Formula | C10H18NOP |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | (3R)-5,5-dimethyl-4-methylidene-1-phosphanyl-3-propylpyrrolidin-2-one |
| SMILES | C=C1[C@@H](CCC)C(=O)N(P)C1(C)C |
| InChI | InChI=1S/C10H18NOP/c1-5-6-8-7(2)10(3,4)11(13)9(8)12/h8H,2,5-6,13H2,1,3-4H3/t8-/m1/s1 |
| InChIKey | DUEYABGKXXBZBI-MRVPVSSYSA-N |
| XLogP | 2.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|