C16H21O2Y- — CID 58774427
3-[(3-ethylcyclobutyl)methyl]-6-methyl-3,5-dihydro-2H-1,4-benzodioxin-5-ide;yttrium (PubChem CID 58774427) has the molecular formula C16H21O2Y- and a molecular weight of 334.25 g/mol. Its IUPAC name is 3-[(3-ethylcyclobutyl)methyl]-6-methyl-3,5-dihydro-2H-1,4-benzodioxin-5-ide;yttrium.
| Compound Name | 3-[(3-ethylcyclobutyl)methyl]-6-methyl-3,5-dihydro-2H-1,4-benzodioxin-5-ide;yttrium |
|---|---|
| PubChem CID | 58774427 |
| Molecular Formula | C16H21O2Y- |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 3-[(3-ethylcyclobutyl)methyl]-6-methyl-3,5-dihydro-2H-1,4-benzodioxin-5-ide;yttrium |
| SMILES | CCC1CC(CC2COc3ccc(C)[c-]c3O2)C1.[Y] |
| InChI | InChI=1S/C16H21O2.Y/c1-3-12-7-13(8-12)9-14-10-17-15-5-4-11(2)6-16(15)18-14;/h4-5,12-14H,3,7-10H2,1-2H3;/q-1; |
| InChIKey | WYAVKOGPEBTWIL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|