C19H26O3 — CID 163541209
4-(2-buta-1,3-dien-2-yloxypropoxy)-1-methoxy-3-methyl-1,2,4a,5-tetrahydronaphthalene (PubChem CID 163541209) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is 4-(2-buta-1,3-dien-2-yloxypropoxy)-1-methoxy-3-methyl-1,2,4a,5-tetrahydronaphthalene.
| Compound Name | 4-(2-buta-1,3-dien-2-yloxypropoxy)-1-methoxy-3-methyl-1,2,4a,5-tetrahydronaphthalene |
|---|---|
| PubChem CID | 163541209 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 4-(2-buta-1,3-dien-2-yloxypropoxy)-1-methoxy-3-methyl-1,2,4a,5-tetrahydronaphthalene |
| SMILES | C=CC(=C)OC(C)COC1=C(C)CC(OC)C2=CC=CCC21 |
| InChI | InChI=1S/C19H26O3/c1-6-14(3)22-15(4)12-21-19-13(2)11-18(20-5)16-9-7-8-10-17(16)19/h6-9,15,17-18H,1,3,10-12H2,2,4-5H3 |
| InChIKey | FBFQWDTWTIWVGK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|