C18H31O2- — CID 59271310
3-ethyl-5,6-dimethyl-4-octoxycyclohexa-2,4-dien-1-olate (PubChem CID 59271310) has the molecular formula C18H31O2- and a molecular weight of 279.44 g/mol. Its IUPAC name is 3-ethyl-5,6-dimethyl-4-octoxycyclohexa-2,4-dien-1-olate.
| Compound Name | 3-ethyl-5,6-dimethyl-4-octoxycyclohexa-2,4-dien-1-olate |
|---|---|
| PubChem CID | 59271310 |
| Molecular Formula | C18H31O2- |
| Molecular Weight | 279.44 g/mol |
| Exact Mass | 279.23 |
| IUPAC Name | 3-ethyl-5,6-dimethyl-4-octoxycyclohexa-2,4-dien-1-olate |
| SMILES | CCCCCCCCOC1=C(C)C(C)C([O-])C=C1CC |
| InChI | InChI=1S/C18H31O2/c1-5-7-8-9-10-11-12-20-18-15(4)14(3)17(19)13-16(18)6-2/h13-14,17H,5-12H2,1-4H3/q-1 |
| InChIKey | OHZUBMPHXRTFEK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|