C20H21ClF4N4O2S — CID 58776130
2-chloro-4-fluoro-5-[3-methyl-6-oxo-2-sulfanylidene-4-(trifluoromethyl)pyrimidin-1-yl]-N-[[prop-2-enyl(propyl)amino]methyl]benzamide (PubChem CID 58776130) has the molecular formula C20H21ClF4N4O2S and a molecular weight of 492.93 g/mol. Its IUPAC name is 2-chloro-4-fluoro-5-[3-methyl-6-oxo-2-sulfanylidene-4-(trifluoromethyl)pyrimidin-1-yl]-N-[[prop-2-enyl(propyl)amino]methyl]benzamide.
| Compound Name | 2-chloro-4-fluoro-5-[3-methyl-6-oxo-2-sulfanylidene-4-(trifluoromethyl)pyrimidin-1-yl]-N-[[prop-2-enyl(propyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 58776130 |
| Molecular Formula | C20H21ClF4N4O2S |
| Molecular Weight | 492.93 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 2-chloro-4-fluoro-5-[3-methyl-6-oxo-2-sulfanylidene-4-(trifluoromethyl)pyrimidin-1-yl]-N-[[prop-2-enyl(propyl)amino]methyl]benzamide |
| SMILES | C=CCN(CCC)CNC(=O)c1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=S)c(F)cc1Cl |
| InChI | InChI=1S/C20H21ClF4N4O2S/c1-4-6-28(7-5-2)11-26-18(31)12-8-15(14(22)9-13(12)21)29-17(30)10-16(20(23,24)25)27(3)19(29)32/h4,8-10H,1,5-7,11H2,2-3H3,(H,26,31) |
| InChIKey | MWHVTOWCAJRKMP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 59.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.93 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|