C9H13N3O — CID 58778084
7-methanidyl-4-methoxy-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-7-ium (PubChem CID 58778084) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is 7-methanidyl-4-methoxy-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-7-ium.
| Compound Name | 7-methanidyl-4-methoxy-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-7-ium |
|---|---|
| PubChem CID | 58778084 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 7-methanidyl-4-methoxy-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-7-ium |
| SMILES | [CH2-][NH+]1CCc2c(ncnc2OC)C1 |
| InChI | InChI=1S/C9H13N3O/c1-12-4-3-7-8(5-12)10-6-11-9(7)13-2/h6,12H,1,3-5H2,2H3 |
| InChIKey | HGVFBXMYTRPISX-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|