C32H28O7 — CID 58778297
1-(9,17-dihydroxy-5,10,16,21-tetramethoxy-13-methyl-7,19-dimethylidene-12-hexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1(15),2(11),3(8),4(22),5,9,12,16,18(23),20-decaenyl)ethanone (PubChem CID 58778297) has the molecular formula C32H28O7 and a molecular weight of 524.57 g/mol. Its IUPAC name is 1-(9,17-dihydroxy-5,10,16,21-tetramethoxy-13-methyl-7,19-dimethylidene-12-hexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1(15),2(11),3(8),4(22),5,9,12,16,18(23),20-decaenyl)ethanone.
| Compound Name | 1-(9,17-dihydroxy-5,10,16,21-tetramethoxy-13-methyl-7,19-dimethylidene-12-hexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1(15),2(11),3(8),4(22),5,9,12,16,18(23),20-decaenyl)ethanone |
|---|---|
| PubChem CID | 58778297 |
| Molecular Formula | C32H28O7 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 1-(9,17-dihydroxy-5,10,16,21-tetramethoxy-13-methyl-7,19-dimethylidene-12-hexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1(15),2(11),3(8),4(22),5,9,12,16,18(23),20-decaenyl)ethanone |
| SMILES | C=c1cc(OC)c2c3c(OC)cc(=C)c4c(O)c(OC)c5c(c6c(c(OC)c(O)c1c26)CC(C)=C5C(C)=O)c43 |
| InChI | InChI=1S/C32H28O7/c1-12-9-16-22-25-20(29(34)31(16)38-7)13(2)10-17(36-5)23(25)24-18(37-6)11-14(3)21-26(24)27(22)28(19(12)15(4)33)32(39-8)30(21)35/h10-11,34-35H,2-3,9H2,1,4-8H3 |
| InChIKey | APVAQGRHNHGCCR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|