C11H19O5S+ — CID 58780042
[2-(1,4-oxathian-4-ium-4-yl)acetyl]oxymethyl 2-methylpropanoate (PubChem CID 58780042) has the molecular formula C11H19O5S+ and a molecular weight of 263.33 g/mol. Its IUPAC name is [2-(1,4-oxathian-4-ium-4-yl)acetyl]oxymethyl 2-methylpropanoate.
| Compound Name | [2-(1,4-oxathian-4-ium-4-yl)acetyl]oxymethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 58780042 |
| Molecular Formula | C11H19O5S+ |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | [2-(1,4-oxathian-4-ium-4-yl)acetyl]oxymethyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCOC(=O)C[S+]1CCOCC1 |
| InChI | InChI=1S/C11H19O5S/c1-9(2)11(13)16-8-15-10(12)7-17-5-3-14-4-6-17/h9H,3-8H2,1-2H3/q+1 |
| InChIKey | LWPBKTNMGUGUPC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|