C10H17O5S+ — CID 58779988
2-acetyloxyethyl 2-(1,4-oxathian-4-ium-4-yl)acetate (PubChem CID 58779988) has the molecular formula C10H17O5S+ and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-acetyloxyethyl 2-(1,4-oxathian-4-ium-4-yl)acetate.
| Compound Name | 2-acetyloxyethyl 2-(1,4-oxathian-4-ium-4-yl)acetate |
|---|---|
| PubChem CID | 58779988 |
| Molecular Formula | C10H17O5S+ |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 2-acetyloxyethyl 2-(1,4-oxathian-4-ium-4-yl)acetate |
| SMILES | CC(=O)OCCOC(=O)C[S+]1CCOCC1 |
| InChI | InChI=1S/C10H17O5S/c1-9(11)14-2-3-15-10(12)8-16-6-4-13-5-7-16/h2-8H2,1H3/q+1 |
| InChIKey | OIRWZAXKTFRDAE-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|