C12H23O5S+ — CID 58779972
2-(2-ethoxyethoxy)ethyl 2-(1,4-oxathian-4-ium-4-yl)acetate (PubChem CID 58779972) has the molecular formula C12H23O5S+ and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)ethyl 2-(1,4-oxathian-4-ium-4-yl)acetate.
| Compound Name | 2-(2-ethoxyethoxy)ethyl 2-(1,4-oxathian-4-ium-4-yl)acetate |
|---|---|
| PubChem CID | 58779972 |
| Molecular Formula | C12H23O5S+ |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-(2-ethoxyethoxy)ethyl 2-(1,4-oxathian-4-ium-4-yl)acetate |
| SMILES | CCOCCOCCOC(=O)C[S+]1CCOCC1 |
| InChI | InChI=1S/C12H23O5S/c1-2-14-3-4-15-5-6-17-12(13)11-18-9-7-16-8-10-18/h2-11H2,1H3/q+1 |
| InChIKey | DAIDOBDTOYDVCP-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|