C22H25Cl2NO3 — CID 58784083
tert-butyl N-[1-(2,5-dichlorophenyl)-1-oxo-5-phenylpentan-2-yl]carbamate (PubChem CID 58784083) has the molecular formula C22H25Cl2NO3 and a molecular weight of 422.35 g/mol. Its IUPAC name is tert-butyl N-[1-(2,5-dichlorophenyl)-1-oxo-5-phenylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2,5-dichlorophenyl)-1-oxo-5-phenylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 58784083 |
| Molecular Formula | C22H25Cl2NO3 |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | tert-butyl N-[1-(2,5-dichlorophenyl)-1-oxo-5-phenylpentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCCc1ccccc1)C(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C22H25Cl2NO3/c1-22(2,3)28-21(27)25-19(11-7-10-15-8-5-4-6-9-15)20(26)17-14-16(23)12-13-18(17)24/h4-6,8-9,12-14,19H,7,10-11H2,1-3H3,(H,25,27) |
| InChIKey | ZPADKEJMZVPNNC-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |