C24H30N2O4 — CID 162773275
tert-butyl N-[(2S)-6-amino-1-(2-benzoylphenyl)-1-oxohexan-2-yl]carbamate (PubChem CID 162773275) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is tert-butyl N-[(2S)-6-amino-1-(2-benzoylphenyl)-1-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-6-amino-1-(2-benzoylphenyl)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 162773275 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | tert-butyl N-[(2S)-6-amino-1-(2-benzoylphenyl)-1-oxohexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCN)C(=O)c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H30N2O4/c1-24(2,3)30-23(29)26-20(15-9-10-16-25)22(28)19-14-8-7-13-18(19)21(27)17-11-5-4-6-12-17/h4-8,11-14,20H,9-10,15-16,25H2,1-3H3,(H,26,29)/t20-/m0/s1 |
| InChIKey | VGBJFXXGCYGASQ-FQEVSTJZSA-N |
| XLogP | 4.12 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|