C21H23F3N4S — CID 58791725
1-N-pentyl-4-N-[4-(pyridin-3-ylmethyl)-1,3-thiazol-2-yl]-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 58791725) has the molecular formula C21H23F3N4S and a molecular weight of 420.50 g/mol. Its IUPAC name is 1-N-pentyl-4-N-[4-(pyridin-3-ylmethyl)-1,3-thiazol-2-yl]-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 1-N-pentyl-4-N-[4-(pyridin-3-ylmethyl)-1,3-thiazol-2-yl]-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 58791725 |
| Molecular Formula | C21H23F3N4S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 1-N-pentyl-4-N-[4-(pyridin-3-ylmethyl)-1,3-thiazol-2-yl]-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | CCCCCNc1ccc(Nc2nc(Cc3cccnc3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H23F3N4S/c1-2-3-4-10-26-19-8-7-16(12-18(19)21(22,23)24)27-20-28-17(14-29-20)11-15-6-5-9-25-13-15/h5-9,12-14,26H,2-4,10-11H2,1H3,(H,27,28) |
| InChIKey | AQVYPISLHRKQGE-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|