About calcium methanidylcyclopentane
calcium methanidylcyclopentane (PubChem CID 58794036) has the molecular formula C6H10Ca
and a molecular weight of 122.22 g/mol. Its IUPAC name is calcium methanidylcyclopentane.
Molecular Properties
| Compound Name | calcium methanidylcyclopentane |
| PubChem CID | 58794036 |
| Molecular Formula | C6H10Ca |
| Molecular Weight | 122.22 g/mol |
| Exact Mass | 122.04 |
| IUPAC Name | calcium methanidylcyclopentane |
| SMILES | [CH2-][C@@H]1C[CH-]CC1.[Ca+2] |
| InChI | InChI=1S/C6H10.Ca/c1-6-4-2-3-5-6;/h2,6H,1,3-5H2;/q-2;+2/t6-;/m1./s1 |
| InChIKey | ISYMWIIEALDXKY-FYZOBXCZSA-N |
| XLogP | 1.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze calcium methanidylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium methanidylcyclopentane?
The IUPAC name of calcium methanidylcyclopentane (CID 58794036) is calcium methanidylcyclopentane.
What is the SMILES notation for calcium methanidylcyclopentane?
The canonical SMILES for calcium methanidylcyclopentane is [CH2-][C@@H]1C[CH-]CC1.[Ca+2].
What is the InChIKey of calcium methanidylcyclopentane?
The InChIKey is ISYMWIIEALDXKY-FYZOBXCZSA-N. The full InChI is InChI=1S/C6H10.Ca/c1-6-4-2-3-5-6;/h2,6H,1,3-5H2;/q-2;+2/t6-;/m1./s1.
What are the key properties of calcium methanidylcyclopentane?
calcium methanidylcyclopentane has a molecular weight of 122.22 g/mol, XLogP of 1.44, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for calcium methanidylcyclopentane is sourced from PubChem (CID 58794036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).