C8H15Y- — CID 59098035
1,2-dimethylcyclohexane;yttrium (PubChem CID 59098035) has the molecular formula C8H15Y- and a molecular weight of 200.11 g/mol. Its IUPAC name is 1,2-dimethylcyclohexane;yttrium.
| Compound Name | 1,2-dimethylcyclohexane;yttrium |
|---|---|
| PubChem CID | 59098035 |
| Molecular Formula | C8H15Y- |
| Molecular Weight | 200.11 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | 1,2-dimethylcyclohexane;yttrium |
| SMILES | CC1C[CH-]CCC1C.[Y] |
| InChI | InChI=1S/C8H15.Y/c1-7-5-3-4-6-8(7)2;/h3,7-8H,4-6H2,1-2H3;/q-1; |
| InChIKey | BLSQRKSHOYYFIM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.11 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|