About bis[2-[2-(2-hydroxypropoxy)propoxy]propyl] 2-(3-hydroxypropoxy)propyl borate
bis[2-[2-(2-hydroxypropoxy)propoxy]propyl] 2-(3-hydroxypropoxy)propyl borate (PubChem CID 58795151) has the molecular formula C24H51BO11
and a molecular weight of 526.47 g/mol. Its IUPAC name is bis[2-[2-(2-hydroxypropoxy)propoxy]propyl] 2-(3-hydroxypropoxy)propyl borate.
Molecular Properties
| Compound Name | bis[2-[2-(2-hydroxypropoxy)propoxy]propyl] 2-(3-hydroxypropoxy)propyl borate |
| PubChem CID | 58795151 |
| Molecular Formula | C24H51BO11 |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 526.35 |
| IUPAC Name | bis[2-[2-(2-hydroxypropoxy)propoxy]propyl] 2-(3-hydroxypropoxy)propyl borate |
| SMILES | CC(O)COC(C)COC(C)COB(OCC(C)OCCCO)OCC(C)OCC(C)OCC(C)O |
| InChI | InChI=1S/C24H51BO11/c1-18(27)11-30-20(3)13-32-23(6)16-35-25(34-15-22(5)29-10-8-9-26)36-17-24(7)33-14-21(4)31-12-19(2)28/h18-24,26-28H,8-17H2,1-7H3 |
| InChIKey | REGYLYHEBIVZDQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 134.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis[2-[2-(2-hydroxypropoxy)propoxy]propyl] 2-(3-hydroxypropoxy)propyl borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-[2-(2-hydroxypropoxy)propoxy]propyl] 2-(3-hydroxypropoxy)propyl borate?
The IUPAC name of bis[2-[2-(2-hydroxypropoxy)propoxy]propyl] 2-(3-hydroxypropoxy)propyl borate (CID 58795151) is bis[2-[2-(2-hydroxypropoxy)propoxy]propyl] 2-(3-hydroxypropoxy)propyl borate.
What is the SMILES notation for bis[2-[2-(2-hydroxypropoxy)propoxy]propyl] 2-(3-hydroxypropoxy)propyl borate?
The canonical SMILES for bis[2-[2-(2-hydroxypropoxy)propoxy]propyl] 2-(3-hydroxypropoxy)propyl borate is CC(O)COC(C)COC(C)COB(OCC(C)OCCCO)OCC(C)OCC(C)OCC(C)O.
What is the InChIKey of bis[2-[2-(2-hydroxypropoxy)propoxy]propyl] 2-(3-hydroxypropoxy)propyl borate?
The InChIKey is REGYLYHEBIVZDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51BO11/c1-18(27)11-30-20(3)13-32-23(6)16-35-25(34-15-22(5)29-10-8-9-26)36-17-24(7)33-14-21(4)31-12-19(2)28/h18-24,26-28H,8-17H2,1-7H3.
What are the key properties of bis[2-[2-(2-hydroxypropoxy)propoxy]propyl] 2-(3-hydroxypropoxy)propyl borate?
bis[2-[2-(2-hydroxypropoxy)propoxy]propyl] 2-(3-hydroxypropoxy)propyl borate has a molecular weight of 526.47 g/mol, XLogP of 1.19, 25 rotatable bonds, 3 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-[2-(2-hydroxypropoxy)propoxy]propyl] 2-(3-hydroxypropoxy)propyl borate is sourced from PubChem (CID 58795151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).