C17H30O3 — CID 58795464
(6S,7R,8S,9S)-6-hydroxy-5,5,7,8,9-pentamethyldodec-11-ene-2,4-dione (PubChem CID 58795464) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is (6S,7R,8S,9S)-6-hydroxy-5,5,7,8,9-pentamethyldodec-11-ene-2,4-dione.
| Compound Name | (6S,7R,8S,9S)-6-hydroxy-5,5,7,8,9-pentamethyldodec-11-ene-2,4-dione |
|---|---|
| PubChem CID | 58795464 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (6S,7R,8S,9S)-6-hydroxy-5,5,7,8,9-pentamethyldodec-11-ene-2,4-dione |
| SMILES | C=CC[C@H](C)[C@H](C)[C@@H](C)[C@H](O)C(C)(C)C(=O)CC(C)=O |
| InChI | InChI=1S/C17H30O3/c1-8-9-11(2)13(4)14(5)16(20)17(6,7)15(19)10-12(3)18/h8,11,13-14,16,20H,1,9-10H2,2-7H3/t11-,13-,14+,16-/m0/s1 |
| InChIKey | UBCRGTNDPJVNTO-ZIEJDFEHSA-N |
| XLogP | 3.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|