About 3-(isocyanatomethyl)-2,4-dimethylpent-2-ene
3-(isocyanatomethyl)-2,4-dimethylpent-2-ene (PubChem CID 58801055) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 3-(isocyanatomethyl)-2,4-dimethylpent-2-ene.
Molecular Properties
| Compound Name | 3-(isocyanatomethyl)-2,4-dimethylpent-2-ene |
| PubChem CID | 58801055 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 3-(isocyanatomethyl)-2,4-dimethylpent-2-ene |
| SMILES | CC(C)=C(CN=C=O)C(C)C |
| InChI | InChI=1S/C9H15NO/c1-7(2)9(8(3)4)5-10-6-11/h7H,5H2,1-4H3 |
| InChIKey | XEJCOBSZSPJHEK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(isocyanatomethyl)-2,4-dimethylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(isocyanatomethyl)-2,4-dimethylpent-2-ene?
The IUPAC name of 3-(isocyanatomethyl)-2,4-dimethylpent-2-ene (CID 58801055) is 3-(isocyanatomethyl)-2,4-dimethylpent-2-ene.
What is the SMILES notation for 3-(isocyanatomethyl)-2,4-dimethylpent-2-ene?
The canonical SMILES for 3-(isocyanatomethyl)-2,4-dimethylpent-2-ene is CC(C)=C(CN=C=O)C(C)C.
What is the InChIKey of 3-(isocyanatomethyl)-2,4-dimethylpent-2-ene?
The InChIKey is XEJCOBSZSPJHEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-7(2)9(8(3)4)5-10-6-11/h7H,5H2,1-4H3.
What are the key properties of 3-(isocyanatomethyl)-2,4-dimethylpent-2-ene?
3-(isocyanatomethyl)-2,4-dimethylpent-2-ene has a molecular weight of 153.22 g/mol, XLogP of 2.31, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(isocyanatomethyl)-2,4-dimethylpent-2-ene is sourced from PubChem (CID 58801055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).