C8H13NO3 — CID 58805093
[(2Z)-3-(hydroxymethyl)penta-2,4-dienyl] N-methylcarbamate (PubChem CID 58805093) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is [(2Z)-3-(hydroxymethyl)penta-2,4-dienyl] N-methylcarbamate.
| Compound Name | [(2Z)-3-(hydroxymethyl)penta-2,4-dienyl] N-methylcarbamate |
|---|---|
| PubChem CID | 58805093 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | [(2Z)-3-(hydroxymethyl)penta-2,4-dienyl] N-methylcarbamate |
| SMILES | C=C/C(=C/COC(=O)NC)CO |
| InChI | InChI=1S/C8H13NO3/c1-3-7(6-10)4-5-12-8(11)9-2/h3-4,10H,1,5-6H2,2H3,(H,9,11)/b7-4- |
| InChIKey | YYFJHOWGKFDYHH-DAXSKMNVSA-N |
| XLogP | 0.45 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|