C23H15F2NS — CID 58807422
7-(4-ethylphenyl)-1,3-difluoro-2-isothiocyanatophenanthrene (PubChem CID 58807422) has the molecular formula C23H15F2NS and a molecular weight of 375.44 g/mol. Its IUPAC name is 7-(4-ethylphenyl)-1,3-difluoro-2-isothiocyanatophenanthrene.
| Compound Name | 7-(4-ethylphenyl)-1,3-difluoro-2-isothiocyanatophenanthrene |
|---|---|
| PubChem CID | 58807422 |
| Molecular Formula | C23H15F2NS |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 7-(4-ethylphenyl)-1,3-difluoro-2-isothiocyanatophenanthrene |
| SMILES | CCc1ccc(-c2ccc3c(ccc4c(F)c(N=C=S)c(F)cc43)c2)cc1 |
| InChI | InChI=1S/C23H15F2NS/c1-2-14-3-5-15(6-4-14)16-7-9-18-17(11-16)8-10-19-20(18)12-21(24)23(22(19)25)26-13-27/h3-12H,2H2,1H3 |
| InChIKey | HMGZOZUCJZQBGM-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|