About 7-(4-ethylphenyl)-1,3-difluoro-2-isothiocyanatophenanthrene
7-(4-ethylphenyl)-1,3-difluoro-2-isothiocyanatophenanthrene (PubChem CID 58807422) has the molecular formula C23H15F2NS
and a molecular weight of 375.44 g/mol. Its IUPAC name is 7-(4-ethylphenyl)-1,3-difluoro-2-isothiocyanatophenanthrene.
Molecular Properties
| Compound Name | 7-(4-ethylphenyl)-1,3-difluoro-2-isothiocyanatophenanthrene |
| PubChem CID | 58807422 |
| Molecular Formula | C23H15F2NS |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 7-(4-ethylphenyl)-1,3-difluoro-2-isothiocyanatophenanthrene |
| SMILES | CCc1ccc(-c2ccc3c(ccc4c(F)c(N=C=S)c(F)cc43)c2)cc1 |
| InChI | InChI=1S/C23H15F2NS/c1-2-14-3-5-15(6-4-14)16-7-9-18-17(11-16)8-10-19-20(18)12-21(24)23(22(19)25)26-13-27/h3-12H,2H2,1H3 |
| InChIKey | HMGZOZUCJZQBGM-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7-(4-ethylphenyl)-1,3-difluoro-2-isothiocyanatophenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-ethylphenyl)-1,3-difluoro-2-isothiocyanatophenanthrene?
The IUPAC name of 7-(4-ethylphenyl)-1,3-difluoro-2-isothiocyanatophenanthrene (CID 58807422) is 7-(4-ethylphenyl)-1,3-difluoro-2-isothiocyanatophenanthrene.
What is the SMILES notation for 7-(4-ethylphenyl)-1,3-difluoro-2-isothiocyanatophenanthrene?
The canonical SMILES for 7-(4-ethylphenyl)-1,3-difluoro-2-isothiocyanatophenanthrene is CCc1ccc(-c2ccc3c(ccc4c(F)c(N=C=S)c(F)cc43)c2)cc1.
What is the InChIKey of 7-(4-ethylphenyl)-1,3-difluoro-2-isothiocyanatophenanthrene?
The InChIKey is HMGZOZUCJZQBGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15F2NS/c1-2-14-3-5-15(6-4-14)16-7-9-18-17(11-16)8-10-19-20(18)12-21(24)23(22(19)25)26-13-27/h3-12H,2H2,1H3.
What are the key properties of 7-(4-ethylphenyl)-1,3-difluoro-2-isothiocyanatophenanthrene?
7-(4-ethylphenyl)-1,3-difluoro-2-isothiocyanatophenanthrene has a molecular weight of 375.44 g/mol, XLogP of 7.23, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-ethylphenyl)-1,3-difluoro-2-isothiocyanatophenanthrene is sourced from PubChem (CID 58807422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).